C19H22N3OS+ — CID 156515811
[4-(1,1-dimethylpiperidin-1-ium-4-yl)-1,3-thiazol-2-yl]-(1H-indol-3-yl)methanone (PubChem CID 156515811) has the molecular formula C19H22N3OS+ and a molecular weight of 340.47 g/mol. Its IUPAC name is [4-(1,1-dimethylpiperidin-1-ium-4-yl)-1,3-thiazol-2-yl]-(1H-indol-3-yl)methanone.
| Compound Name | [4-(1,1-dimethylpiperidin-1-ium-4-yl)-1,3-thiazol-2-yl]-(1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 156515811 |
| Molecular Formula | C19H22N3OS+ |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | [4-(1,1-dimethylpiperidin-1-ium-4-yl)-1,3-thiazol-2-yl]-(1H-indol-3-yl)methanone |
| SMILES | C[N+]1(C)CCC(c2csc(C(=O)c3c[nH]c4ccccc34)n2)CC1 |
| InChI | InChI=1S/C19H21N3OS/c1-22(2)9-7-13(8-10-22)17-12-24-19(21-17)18(23)15-11-20-16-6-4-3-5-14(15)16/h3-6,11-13H,7-10H2,1-2H3/p+1 |
| InChIKey | YNIJUVZRYUGZJE-UHFFFAOYSA-O |
| XLogP | 3.81 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|