C23H29N4O2S+ — CID 156515501
[3-[4-[2-(1H-indole-3-carbonyl)-1,3-thiazol-4-yl]piperidin-1-yl]-3-oxopropyl]-trimethylazanium (PubChem CID 156515501) has the molecular formula C23H29N4O2S+ and a molecular weight of 425.58 g/mol. Its IUPAC name is [3-[4-[2-(1H-indole-3-carbonyl)-1,3-thiazol-4-yl]piperidin-1-yl]-3-oxopropyl]-trimethylazanium.
| Compound Name | [3-[4-[2-(1H-indole-3-carbonyl)-1,3-thiazol-4-yl]piperidin-1-yl]-3-oxopropyl]-trimethylazanium |
|---|---|
| PubChem CID | 156515501 |
| Molecular Formula | C23H29N4O2S+ |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | [3-[4-[2-(1H-indole-3-carbonyl)-1,3-thiazol-4-yl]piperidin-1-yl]-3-oxopropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CCC(=O)N1CCC(c2csc(C(=O)c3c[nH]c4ccccc34)n2)CC1 |
| InChI | InChI=1S/C23H28N4O2S/c1-27(2,3)13-10-21(28)26-11-8-16(9-12-26)20-15-30-23(25-20)22(29)18-14-24-19-7-5-4-6-17(18)19/h4-7,14-16H,8-13H2,1-3H3/p+1 |
| InChIKey | XVKILASWOLFRGD-UHFFFAOYSA-O |
| XLogP | 3.66 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|