C14H8F3N3O2S — CID 70536916
4-oxo-N-(1,3-thiazol-2-yl)-N-(trifluoromethyl)-1H-quinoline-3-carboxamide (PubChem CID 70536916) has the molecular formula C14H8F3N3O2S and a molecular weight of 339.30 g/mol. Its IUPAC name is 4-oxo-N-(1,3-thiazol-2-yl)-N-(trifluoromethyl)-1H-quinoline-3-carboxamide.
| Compound Name | 4-oxo-N-(1,3-thiazol-2-yl)-N-(trifluoromethyl)-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 70536916 |
| Molecular Formula | C14H8F3N3O2S |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 4-oxo-N-(1,3-thiazol-2-yl)-N-(trifluoromethyl)-1H-quinoline-3-carboxamide |
| SMILES | O=C(c1c[nH]c2ccccc2c1=O)N(c1nccs1)C(F)(F)F |
| InChI | InChI=1S/C14H8F3N3O2S/c15-14(16,17)20(13-18-5-6-23-13)12(22)9-7-19-10-4-2-1-3-8(10)11(9)21/h1-7H,(H,19,21) |
| InChIKey | YQYPSDMMSJIJGB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|