C10H6N2O3 — CID 118327935
N,4-dioxo-1H-quinoline-3-carboxamide (PubChem CID 118327935) has the molecular formula C10H6N2O3 and a molecular weight of 202.17 g/mol. Its IUPAC name is N,4-dioxo-1H-quinoline-3-carboxamide.
| Compound Name | N,4-dioxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 118327935 |
| Molecular Formula | C10H6N2O3 |
| Molecular Weight | 202.17 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | N,4-dioxo-1H-quinoline-3-carboxamide |
| SMILES | O=NC(=O)c1c[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C10H6N2O3/c13-9-6-3-1-2-4-8(6)11-5-7(9)10(14)12-15/h1-5H,(H,11,13) |
| InChIKey | KSSISXCYDDLEHR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 79.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.17 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |