C17H15FN2OS — CID 58217438
1-[1-[(E)-but-2-enyl]-6-fluoroindol-3-yl]-2-(1,3-thiazol-2-yl)ethanone (PubChem CID 58217438) has the molecular formula C17H15FN2OS and a molecular weight of 314.39 g/mol. Its IUPAC name is 1-[1-[(E)-but-2-enyl]-6-fluoroindol-3-yl]-2-(1,3-thiazol-2-yl)ethanone.
| Compound Name | 1-[1-[(E)-but-2-enyl]-6-fluoroindol-3-yl]-2-(1,3-thiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 58217438 |
| Molecular Formula | C17H15FN2OS |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-[1-[(E)-but-2-enyl]-6-fluoroindol-3-yl]-2-(1,3-thiazol-2-yl)ethanone |
| SMILES | C/C=C/Cn1cc(C(=O)Cc2nccs2)c2ccc(F)cc21 |
| InChI | InChI=1S/C17H15FN2OS/c1-2-3-7-20-11-14(13-5-4-12(18)9-15(13)20)16(21)10-17-19-6-8-22-17/h2-6,8-9,11H,7,10H2,1H3/b3-2+ |
| InChIKey | OALPGMGJJCHNIS-NSCUHMNNSA-N |
| XLogP | 4.24 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|