C18H15FN4O3S — CID 506354
1-(4-fluoro-1H-indol-3-yl)-2-[4-(1,3-thiazole-4-carbonyl)piperazin-1-yl]ethane-1,2-dione (PubChem CID 506354) has the molecular formula C18H15FN4O3S and a molecular weight of 386.41 g/mol. Its IUPAC name is 1-(4-fluoro-1H-indol-3-yl)-2-[4-(1,3-thiazole-4-carbonyl)piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(4-fluoro-1H-indol-3-yl)-2-[4-(1,3-thiazole-4-carbonyl)piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 506354 |
| Molecular Formula | C18H15FN4O3S |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 1-(4-fluoro-1H-indol-3-yl)-2-[4-(1,3-thiazole-4-carbonyl)piperazin-1-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(C(=O)c2cscn2)CC1)c1c[nH]c2cccc(F)c12 |
| InChI | InChI=1S/C18H15FN4O3S/c19-12-2-1-3-13-15(12)11(8-20-13)16(24)18(26)23-6-4-22(5-7-23)17(25)14-9-27-10-21-14/h1-3,8-10,20H,4-7H2 |
| InChIKey | HJHLFRALOIPOMA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|