C25H20FN3O3S — CID 507830
1-(4-benzoylpiperazin-1-yl)-2-(4-fluoro-7-thiophen-3-yl-1H-indol-3-yl)ethane-1,2-dione (PubChem CID 507830) has the molecular formula C25H20FN3O3S and a molecular weight of 461.52 g/mol. Its IUPAC name is 1-(4-benzoylpiperazin-1-yl)-2-(4-fluoro-7-thiophen-3-yl-1H-indol-3-yl)ethane-1,2-dione.
| Compound Name | 1-(4-benzoylpiperazin-1-yl)-2-(4-fluoro-7-thiophen-3-yl-1H-indol-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 507830 |
| Molecular Formula | C25H20FN3O3S |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 1-(4-benzoylpiperazin-1-yl)-2-(4-fluoro-7-thiophen-3-yl-1H-indol-3-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(C(=O)c2ccccc2)CC1)c1c[nH]c2c(-c3ccsc3)ccc(F)c12 |
| InChI | InChI=1S/C25H20FN3O3S/c26-20-7-6-18(17-8-13-33-15-17)22-21(20)19(14-27-22)23(30)25(32)29-11-9-28(10-12-29)24(31)16-4-2-1-3-5-16/h1-8,13-15,27H,9-12H2 |
| InChIKey | XFOWEKUCAOAHPD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|