C14H9FN3O5PS — CID 166829968
[3-(4-cyano-1,3-thiazole-2-carbonyl)-7-fluoroindol-1-yl]methyl dihydrogen phosphate (PubChem CID 166829968) has the molecular formula C14H9FN3O5PS and a molecular weight of 381.28 g/mol. Its IUPAC name is [3-(4-cyano-1,3-thiazole-2-carbonyl)-7-fluoroindol-1-yl]methyl dihydrogen phosphate.
| Compound Name | [3-(4-cyano-1,3-thiazole-2-carbonyl)-7-fluoroindol-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 166829968 |
| Molecular Formula | C14H9FN3O5PS |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | [3-(4-cyano-1,3-thiazole-2-carbonyl)-7-fluoroindol-1-yl]methyl dihydrogen phosphate |
| SMILES | N#Cc1csc(C(=O)c2cn(COP(=O)(O)O)c3c(F)cccc23)n1 |
| InChI | InChI=1S/C14H9FN3O5PS/c15-11-3-1-2-9-10(13(19)14-17-8(4-16)6-25-14)5-18(12(9)11)7-23-24(20,21)22/h1-3,5-6H,7H2,(H2,20,21,22) |
| InChIKey | STRJMLSITQWVGN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 125.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|