C21H27BrN2O5SSi — CID 158770883
methyl 5-bromo-2-[hydroxy-[6-methoxy-1-(2-trimethylsilylethoxymethyl)indol-3-yl]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 158770883) has the molecular formula C21H27BrN2O5SSi and a molecular weight of 527.51 g/mol. Its IUPAC name is methyl 5-bromo-2-[hydroxy-[6-methoxy-1-(2-trimethylsilylethoxymethyl)indol-3-yl]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 5-bromo-2-[hydroxy-[6-methoxy-1-(2-trimethylsilylethoxymethyl)indol-3-yl]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 158770883 |
| Molecular Formula | C21H27BrN2O5SSi |
| Molecular Weight | 527.51 g/mol |
| Exact Mass | 526.06 |
| IUPAC Name | methyl 5-bromo-2-[hydroxy-[6-methoxy-1-(2-trimethylsilylethoxymethyl)indol-3-yl]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc(C(O)c2cn(COCC[Si](C)(C)C)c3cc(OC)ccc23)sc1Br |
| InChI | InChI=1S/C21H27BrN2O5SSi/c1-27-13-6-7-14-15(18(25)20-23-17(19(22)30-20)21(26)28-2)11-24(16(14)10-13)12-29-8-9-31(3,4)5/h6-7,10-11,18,25H,8-9,12H2,1-5H3 |
| InChIKey | IPVSQBXLBDVIBS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|