C15H28N2OSi — CID 166517472
trimethyl-[2-[[2-[[(2S)-2-methylazetidin-1-yl]methyl]pyrrol-1-yl]methoxy]ethyl]silane (PubChem CID 166517472) has the molecular formula C15H28N2OSi and a molecular weight of 280.49 g/mol. Its IUPAC name is trimethyl-[2-[[2-[[(2S)-2-methylazetidin-1-yl]methyl]pyrrol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[2-[[(2S)-2-methylazetidin-1-yl]methyl]pyrrol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 166517472 |
| Molecular Formula | C15H28N2OSi |
| Molecular Weight | 280.49 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | trimethyl-[2-[[2-[[(2S)-2-methylazetidin-1-yl]methyl]pyrrol-1-yl]methoxy]ethyl]silane |
| SMILES | C[C@H]1CCN1Cc1cccn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C15H28N2OSi/c1-14-7-9-16(14)12-15-6-5-8-17(15)13-18-10-11-19(2,3)4/h5-6,8,14H,7,9-13H2,1-4H3/t14-/m0/s1 |
| InChIKey | HOBVAVYWNSXRTI-AWEZNQCLSA-N |
| XLogP | 3.39 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|