C19H32N4OSi — CID 156794344
2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-6-amine (PubChem CID 156794344) has the molecular formula C19H32N4OSi and a molecular weight of 360.58 g/mol. Its IUPAC name is 2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-6-amine.
| Compound Name | 2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-6-amine |
|---|---|
| PubChem CID | 156794344 |
| Molecular Formula | C19H32N4OSi |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-6-amine |
| SMILES | C[C@H]1CCCN1Cc1cc2ncc(N)cc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C19H32N4OSi/c1-15-6-5-7-22(15)13-17-11-18-19(10-16(20)12-21-18)23(17)14-24-8-9-25(2,3)4/h10-12,15H,5-9,13-14,20H2,1-4H3/t15-/m0/s1 |
| InChIKey | AAFSUWYZLAPFJW-HNNXBMFYSA-N |
| XLogP | 3.92 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|