C28H38N6O2Si — CID 166517471
1-methyl-N-[2-[[(2R)-2-methylpyrrolidin-1-yl]methyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-yl]indazole-5-carboxamide (PubChem CID 166517471) has the molecular formula C28H38N6O2Si and a molecular weight of 518.74 g/mol. Its IUPAC name is 1-methyl-N-[2-[[(2R)-2-methylpyrrolidin-1-yl]methyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-yl]indazole-5-carboxamide.
| Compound Name | 1-methyl-N-[2-[[(2R)-2-methylpyrrolidin-1-yl]methyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-yl]indazole-5-carboxamide |
|---|---|
| PubChem CID | 166517471 |
| Molecular Formula | C28H38N6O2Si |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | 1-methyl-N-[2-[[(2R)-2-methylpyrrolidin-1-yl]methyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-yl]indazole-5-carboxamide |
| SMILES | C[C@@H]1CCCN1Cc1cc2cnc(NC(=O)c3ccc4c(cnn4C)c3)cc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C28H38N6O2Si/c1-20-7-6-10-33(20)18-24-14-23-16-29-27(15-26(23)34(24)19-36-11-12-37(3,4)5)31-28(35)21-8-9-25-22(13-21)17-30-32(25)2/h8-9,13-17,20H,6-7,10-12,18-19H2,1-5H3,(H,29,31,35)/t20-/m1/s1 |
| InChIKey | URIFMRRUWFZGQQ-HXUWFJFHSA-N |
| XLogP | 5.47 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|