C26H35N7O2Si — CID 171474879
1-methyl-N-[2-(1-methylpyrrolidin-2-yl)-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-c]pyridin-6-yl]indazole-5-carboxamide (PubChem CID 171474879) has the molecular formula C26H35N7O2Si and a molecular weight of 505.70 g/mol. Its IUPAC name is 1-methyl-N-[2-(1-methylpyrrolidin-2-yl)-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-c]pyridin-6-yl]indazole-5-carboxamide.
| Compound Name | 1-methyl-N-[2-(1-methylpyrrolidin-2-yl)-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-c]pyridin-6-yl]indazole-5-carboxamide |
|---|---|
| PubChem CID | 171474879 |
| Molecular Formula | C26H35N7O2Si |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | 1-methyl-N-[2-(1-methylpyrrolidin-2-yl)-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-c]pyridin-6-yl]indazole-5-carboxamide |
| SMILES | CN1CCCC1c1nc2cnc(NC(=O)c3ccc4c(cnn4C)c3)cc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C26H35N7O2Si/c1-31-10-6-7-22(31)25-29-20-16-27-24(14-23(20)33(25)17-35-11-12-36(3,4)5)30-26(34)18-8-9-21-19(13-18)15-28-32(21)2/h8-9,13-16,22H,6-7,10-12,17H2,1-5H3,(H,27,30,34) |
| InChIKey | GLAGNUCOCKPAMZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|