C27H35N5O4Si — CID 156794328
N-[2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-yl]-2-oxo-3H-1,3-benzoxazole-5-carboxamide (PubChem CID 156794328) has the molecular formula C27H35N5O4Si and a molecular weight of 521.69 g/mol. Its IUPAC name is N-[2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-yl]-2-oxo-3H-1,3-benzoxazole-5-carboxamide.
| Compound Name | N-[2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-yl]-2-oxo-3H-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 156794328 |
| Molecular Formula | C27H35N5O4Si |
| Molecular Weight | 521.69 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | N-[2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-yl]-2-oxo-3H-1,3-benzoxazole-5-carboxamide |
| SMILES | C[C@H]1CCCN1Cc1cc2cnc(NC(=O)c3ccc4oc(=O)[nH]c4c3)cc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C27H35N5O4Si/c1-18-6-5-9-31(18)16-21-12-20-15-28-25(14-23(20)32(21)17-35-10-11-37(2,3)4)30-26(33)19-7-8-24-22(13-19)29-27(34)36-24/h7-8,12-15,18H,5-6,9-11,16-17H2,1-4H3,(H,29,34)(H,28,30,33)/t18-/m0/s1 |
| InChIKey | JFOMEZILPPHVEK-SFHVURJKSA-N |
| XLogP | 5.02 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.69 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|