C28H36N6O3Si — CID 167321952
1-methyl-N-[2-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-yl]indazole-5-carboxamide (PubChem CID 167321952) has the molecular formula C28H36N6O3Si and a molecular weight of 532.72 g/mol. Its IUPAC name is 1-methyl-N-[2-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-yl]indazole-5-carboxamide.
| Compound Name | 1-methyl-N-[2-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-yl]indazole-5-carboxamide |
|---|---|
| PubChem CID | 167321952 |
| Molecular Formula | C28H36N6O3Si |
| Molecular Weight | 532.72 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 1-methyl-N-[2-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-yl]indazole-5-carboxamide |
| SMILES | Cn1ncc2cc(C(=O)Nc3cc4c(cn3)cc(CN3CC5(COC5)C3)n4COCC[Si](C)(C)C)ccc21 |
| InChI | InChI=1S/C28H36N6O3Si/c1-32-24-6-5-20(9-21(24)13-30-32)27(35)31-26-11-25-22(12-29-26)10-23(14-33-15-28(16-33)17-37-18-28)34(25)19-36-7-8-38(2,3)4/h5-6,9-13H,7-8,14-19H2,1-4H3,(H,29,31,35) |
| InChIKey | UVZOTBFUDSKFAV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.72 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|