C32H39N7O2Si — CID 156794321
N-[2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-yl]-1-pyridin-4-ylindazole-5-carboxamide (PubChem CID 156794321) has the molecular formula C32H39N7O2Si and a molecular weight of 581.80 g/mol. Its IUPAC name is N-[2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-yl]-1-pyridin-4-ylindazole-5-carboxamide.
| Compound Name | N-[2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-yl]-1-pyridin-4-ylindazole-5-carboxamide |
|---|---|
| PubChem CID | 156794321 |
| Molecular Formula | C32H39N7O2Si |
| Molecular Weight | 581.80 g/mol |
| Exact Mass | 581.29 |
| IUPAC Name | N-[2-[[(2S)-2-methylpyrrolidin-1-yl]methyl]-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridin-6-yl]-1-pyridin-4-ylindazole-5-carboxamide |
| SMILES | C[C@H]1CCCN1Cc1cc2cnc(NC(=O)c3ccc4c(cnn4-c4ccncc4)c3)cc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C32H39N7O2Si/c1-23-6-5-13-37(23)21-28-17-26-19-34-31(18-30(26)38(28)22-41-14-15-42(2,3)4)36-32(40)24-7-8-29-25(16-24)20-35-39(29)27-9-11-33-12-10-27/h7-12,16-20,23H,5-6,13-15,21-22H2,1-4H3,(H,34,36,40)/t23-/m0/s1 |
| InChIKey | CVHNFSFOXYIGMB-QHCPKHFHSA-N |
| XLogP | 6.32 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.80 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|