C15H28ClN3O2Si — CID 156708312
2-[[4-chloro-2-(1-methylpiperidin-4-yl)oxyimidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 156708312) has the molecular formula C15H28ClN3O2Si and a molecular weight of 345.95 g/mol. Its IUPAC name is 2-[[4-chloro-2-(1-methylpiperidin-4-yl)oxyimidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-chloro-2-(1-methylpiperidin-4-yl)oxyimidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 156708312 |
| Molecular Formula | C15H28ClN3O2Si |
| Molecular Weight | 345.95 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 2-[[4-chloro-2-(1-methylpiperidin-4-yl)oxyimidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CN1CCC(Oc2nc(Cl)cn2COCC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C15H28ClN3O2Si/c1-18-7-5-13(6-8-18)21-15-17-14(16)11-19(15)12-20-9-10-22(2,3)4/h11,13H,5-10,12H2,1-4H3 |
| InChIKey | ZRDRKUWNZLDKIT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.95 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|