C16H27N3OSi — CID 89094435
2-[[4-ethynyl-2-[(2S)-1-methylpyrrolidin-2-yl]imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 89094435) has the molecular formula C16H27N3OSi and a molecular weight of 305.50 g/mol. Its IUPAC name is 2-[[4-ethynyl-2-[(2S)-1-methylpyrrolidin-2-yl]imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-ethynyl-2-[(2S)-1-methylpyrrolidin-2-yl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 89094435 |
| Molecular Formula | C16H27N3OSi |
| Molecular Weight | 305.50 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 2-[[4-ethynyl-2-[(2S)-1-methylpyrrolidin-2-yl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C#Cc1cn(COCC[Si](C)(C)C)c([C@@H]2CCCN2C)n1 |
| InChI | InChI=1S/C16H27N3OSi/c1-6-14-12-19(13-20-10-11-21(3,4)5)16(17-14)15-8-7-9-18(15)2/h1,12,15H,7-11,13H2,2-5H3/t15-/m0/s1 |
| InChIKey | BYHROFNOMWDPNY-HNNXBMFYSA-N |
| XLogP | 2.94 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|