C26H38N4O3Si — CID 59509566
benzyl (2S)-2-[4-(1,2,3,6-tetrahydropyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 59509566) has the molecular formula C26H38N4O3Si and a molecular weight of 482.70 g/mol. Its IUPAC name is benzyl (2S)-2-[4-(1,2,3,6-tetrahydropyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-[4-(1,2,3,6-tetrahydropyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59509566 |
| Molecular Formula | C26H38N4O3Si |
| Molecular Weight | 482.70 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | benzyl (2S)-2-[4-(1,2,3,6-tetrahydropyridin-4-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | C[Si](C)(C)CCOCn1cc(C2=CCNCC2)nc1[C@@H]1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H38N4O3Si/c1-34(2,3)17-16-32-20-29-18-23(22-11-13-27-14-12-22)28-25(29)24-10-7-15-30(24)26(31)33-19-21-8-5-4-6-9-21/h4-6,8-9,11,18,24,27H,7,10,12-17,19-20H2,1-3H3/t24-/m0/s1 |
| InChIKey | LZUXZFAMOCELKT-DEOSSOPVSA-N |
| XLogP | 5.05 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.70 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|