C11H19N3O — CID 168941227
1-(2-methoxyethyl)-2-[(2S)-1-methylpyrrolidin-2-yl]imidazole (PubChem CID 168941227) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-2-[(2S)-1-methylpyrrolidin-2-yl]imidazole.
| Compound Name | 1-(2-methoxyethyl)-2-[(2S)-1-methylpyrrolidin-2-yl]imidazole |
|---|---|
| PubChem CID | 168941227 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 1-(2-methoxyethyl)-2-[(2S)-1-methylpyrrolidin-2-yl]imidazole |
| SMILES | COCCn1ccnc1[C@@H]1CCCN1C |
| InChI | InChI=1S/C11H19N3O/c1-13-6-3-4-10(13)11-12-5-7-14(11)8-9-15-2/h5,7,10H,3-4,6,8-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | JWXBVSYNQCBWKL-JTQLQIEISA-N |
| XLogP | 1.30 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |