C16H21FN4O — CID 97128849
3-fluoro-2-[(3R)-3-[1-(2-methoxyethyl)imidazol-2-yl]piperidin-1-yl]pyridine (PubChem CID 97128849) has the molecular formula C16H21FN4O and a molecular weight of 304.37 g/mol. Its IUPAC name is 3-fluoro-2-[(3R)-3-[1-(2-methoxyethyl)imidazol-2-yl]piperidin-1-yl]pyridine.
| Compound Name | 3-fluoro-2-[(3R)-3-[1-(2-methoxyethyl)imidazol-2-yl]piperidin-1-yl]pyridine |
|---|---|
| PubChem CID | 97128849 |
| Molecular Formula | C16H21FN4O |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 3-fluoro-2-[(3R)-3-[1-(2-methoxyethyl)imidazol-2-yl]piperidin-1-yl]pyridine |
| SMILES | COCCn1ccnc1[C@@H]1CCCN(c2ncccc2F)C1 |
| InChI | InChI=1S/C16H21FN4O/c1-22-11-10-20-9-7-19-15(20)13-4-3-8-21(12-13)16-14(17)5-2-6-18-16/h2,5-7,9,13H,3-4,8,10-12H2,1H3/t13-/m1/s1 |
| InChIKey | PIKKVVCZGDQGJO-CYBMUJFWSA-N |
| XLogP | 2.45 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |