C17H23FN4 — CID 97203412
4-[(3R)-3-(1-butylimidazol-2-yl)piperidin-1-yl]-3-fluoropyridine (PubChem CID 97203412) has the molecular formula C17H23FN4 and a molecular weight of 302.40 g/mol. Its IUPAC name is 4-[(3R)-3-(1-butylimidazol-2-yl)piperidin-1-yl]-3-fluoropyridine.
| Compound Name | 4-[(3R)-3-(1-butylimidazol-2-yl)piperidin-1-yl]-3-fluoropyridine |
|---|---|
| PubChem CID | 97203412 |
| Molecular Formula | C17H23FN4 |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 4-[(3R)-3-(1-butylimidazol-2-yl)piperidin-1-yl]-3-fluoropyridine |
| SMILES | CCCCn1ccnc1[C@@H]1CCCN(c2ccncc2F)C1 |
| InChI | InChI=1S/C17H23FN4/c1-2-3-9-21-11-8-20-17(21)14-5-4-10-22(13-14)16-6-7-19-12-15(16)18/h6-8,11-12,14H,2-5,9-10,13H2,1H3/t14-/m1/s1 |
| InChIKey | QRZDBGGYDGFOIW-CQSZACIVSA-N |
| XLogP | 3.60 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |