C20H31N5 — CID 72857071
4-[3-(1-butylimidazol-2-yl)piperidin-1-yl]-2-methyl-6-propylpyrimidine (PubChem CID 72857071) has the molecular formula C20H31N5 and a molecular weight of 341.50 g/mol. Its IUPAC name is 4-[3-(1-butylimidazol-2-yl)piperidin-1-yl]-2-methyl-6-propylpyrimidine.
| Compound Name | 4-[3-(1-butylimidazol-2-yl)piperidin-1-yl]-2-methyl-6-propylpyrimidine |
|---|---|
| PubChem CID | 72857071 |
| Molecular Formula | C20H31N5 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | 4-[3-(1-butylimidazol-2-yl)piperidin-1-yl]-2-methyl-6-propylpyrimidine |
| SMILES | CCCCn1ccnc1C1CCCN(c2cc(CCC)nc(C)n2)C1 |
| InChI | InChI=1S/C20H31N5/c1-4-6-11-24-13-10-21-20(24)17-9-7-12-25(15-17)19-14-18(8-5-2)22-16(3)23-19/h10,13-14,17H,4-9,11-12,15H2,1-3H3 |
| InChIKey | XUKSKSSBSSRXMX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |