C22H27FN4 — CID 97209448
2-[(3R)-3-(1-butylimidazol-2-yl)piperidin-1-yl]-6-fluoro-4-methylquinoline (PubChem CID 97209448) has the molecular formula C22H27FN4 and a molecular weight of 366.48 g/mol. Its IUPAC name is 2-[(3R)-3-(1-butylimidazol-2-yl)piperidin-1-yl]-6-fluoro-4-methylquinoline.
| Compound Name | 2-[(3R)-3-(1-butylimidazol-2-yl)piperidin-1-yl]-6-fluoro-4-methylquinoline |
|---|---|
| PubChem CID | 97209448 |
| Molecular Formula | C22H27FN4 |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 2-[(3R)-3-(1-butylimidazol-2-yl)piperidin-1-yl]-6-fluoro-4-methylquinoline |
| SMILES | CCCCn1ccnc1[C@@H]1CCCN(c2cc(C)c3cc(F)ccc3n2)C1 |
| InChI | InChI=1S/C22H27FN4/c1-3-4-10-26-12-9-24-22(26)17-6-5-11-27(15-17)21-13-16(2)19-14-18(23)7-8-20(19)25-21/h7-9,12-14,17H,3-6,10-11,15H2,1-2H3/t17-/m1/s1 |
| InChIKey | CBMDCCCKUHFXGS-QGZVFWFLSA-N |
| XLogP | 5.06 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |