C21H26N4S — CID 97128222
2-[(3S)-3-(1-ethylimidazol-2-yl)piperidin-1-yl]-4-methyl-6-methylsulfanylquinoline (PubChem CID 97128222) has the molecular formula C21H26N4S and a molecular weight of 366.53 g/mol. Its IUPAC name is 2-[(3S)-3-(1-ethylimidazol-2-yl)piperidin-1-yl]-4-methyl-6-methylsulfanylquinoline.
| Compound Name | 2-[(3S)-3-(1-ethylimidazol-2-yl)piperidin-1-yl]-4-methyl-6-methylsulfanylquinoline |
|---|---|
| PubChem CID | 97128222 |
| Molecular Formula | C21H26N4S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 2-[(3S)-3-(1-ethylimidazol-2-yl)piperidin-1-yl]-4-methyl-6-methylsulfanylquinoline |
| SMILES | CCn1ccnc1[C@H]1CCCN(c2cc(C)c3cc(SC)ccc3n2)C1 |
| InChI | InChI=1S/C21H26N4S/c1-4-24-11-9-22-21(24)16-6-5-10-25(14-16)20-12-15(2)18-13-17(26-3)7-8-19(18)23-20/h7-9,11-13,16H,4-6,10,14H2,1-3H3/t16-/m0/s1 |
| InChIKey | WILMWOHAZLLVSJ-INIZCTEOSA-N |
| XLogP | 4.87 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |