C18H24N4OS — CID 97121117
(3R)-3-(1-ethylimidazol-2-yl)-N-(4-methylsulfanylphenyl)piperidine-1-carboxamide (PubChem CID 97121117) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is (3R)-3-(1-ethylimidazol-2-yl)-N-(4-methylsulfanylphenyl)piperidine-1-carboxamide.
| Compound Name | (3R)-3-(1-ethylimidazol-2-yl)-N-(4-methylsulfanylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97121117 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (3R)-3-(1-ethylimidazol-2-yl)-N-(4-methylsulfanylphenyl)piperidine-1-carboxamide |
| SMILES | CCn1ccnc1[C@@H]1CCCN(C(=O)Nc2ccc(SC)cc2)C1 |
| InChI | InChI=1S/C18H24N4OS/c1-3-21-12-10-19-17(21)14-5-4-11-22(13-14)18(23)20-15-6-8-16(24-2)9-7-15/h6-10,12,14H,3-5,11,13H2,1-2H3,(H,20,23)/t14-/m1/s1 |
| InChIKey | XTSZYEMHRPXFEO-CQSZACIVSA-N |
| XLogP | 4.04 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |