C18H21F3N4O — CID 97120414
(3R)-3-(1-ethylimidazol-2-yl)-N-[2-(trifluoromethyl)phenyl]piperidine-1-carboxamide (PubChem CID 97120414) has the molecular formula C18H21F3N4O and a molecular weight of 366.39 g/mol. Its IUPAC name is (3R)-3-(1-ethylimidazol-2-yl)-N-[2-(trifluoromethyl)phenyl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-(1-ethylimidazol-2-yl)-N-[2-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97120414 |
| Molecular Formula | C18H21F3N4O |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (3R)-3-(1-ethylimidazol-2-yl)-N-[2-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
| SMILES | CCn1ccnc1[C@@H]1CCCN(C(=O)Nc2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C18H21F3N4O/c1-2-24-11-9-22-16(24)13-6-5-10-25(12-13)17(26)23-15-8-4-3-7-14(15)18(19,20)21/h3-4,7-9,11,13H,2,5-6,10,12H2,1H3,(H,23,26)/t13-/m1/s1 |
| InChIKey | XXBMMOIXTSXZIR-CYBMUJFWSA-N |
| XLogP | 4.33 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |