C20H25ClN4O — CID 97187128
(3R)-N-(2-chlorophenyl)-3-[1-(cyclobutylmethyl)imidazol-2-yl]piperidine-1-carboxamide (PubChem CID 97187128) has the molecular formula C20H25ClN4O and a molecular weight of 372.90 g/mol. Its IUPAC name is (3R)-N-(2-chlorophenyl)-3-[1-(cyclobutylmethyl)imidazol-2-yl]piperidine-1-carboxamide.
| Compound Name | (3R)-N-(2-chlorophenyl)-3-[1-(cyclobutylmethyl)imidazol-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97187128 |
| Molecular Formula | C20H25ClN4O |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (3R)-N-(2-chlorophenyl)-3-[1-(cyclobutylmethyl)imidazol-2-yl]piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)N1CCC[C@@H](c2nccn2CC2CCC2)C1 |
| InChI | InChI=1S/C20H25ClN4O/c21-17-8-1-2-9-18(17)23-20(26)25-11-4-7-16(14-25)19-22-10-12-24(19)13-15-5-3-6-15/h1-2,8-10,12,15-16H,3-7,11,13-14H2,(H,23,26)/t16-/m1/s1 |
| InChIKey | NFJGFLYMLWDLKB-MRXNPFEDSA-N |
| XLogP | 4.75 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |