C18H22FN3O2 — CID 97116494
1-[(3R)-3-(1-ethylimidazol-2-yl)piperidin-1-yl]-2-(4-fluorophenoxy)ethanone (PubChem CID 97116494) has the molecular formula C18H22FN3O2 and a molecular weight of 331.39 g/mol. Its IUPAC name is 1-[(3R)-3-(1-ethylimidazol-2-yl)piperidin-1-yl]-2-(4-fluorophenoxy)ethanone.
| Compound Name | 1-[(3R)-3-(1-ethylimidazol-2-yl)piperidin-1-yl]-2-(4-fluorophenoxy)ethanone |
|---|---|
| PubChem CID | 97116494 |
| Molecular Formula | C18H22FN3O2 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-[(3R)-3-(1-ethylimidazol-2-yl)piperidin-1-yl]-2-(4-fluorophenoxy)ethanone |
| SMILES | CCn1ccnc1[C@@H]1CCCN(C(=O)COc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C18H22FN3O2/c1-2-21-11-9-20-18(21)14-4-3-10-22(12-14)17(23)13-24-16-7-5-15(19)6-8-16/h5-9,11,14H,2-4,10,12-13H2,1H3/t14-/m1/s1 |
| InChIKey | QZNSOVKDYFQKDS-CQSZACIVSA-N |
| XLogP | 2.83 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |