C15H23N3O — CID 97284839
(E)-1-[(3R)-3-(1-ethylimidazol-2-yl)piperidin-1-yl]pent-3-en-1-one (PubChem CID 97284839) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is (E)-1-[(3R)-3-(1-ethylimidazol-2-yl)piperidin-1-yl]pent-3-en-1-one.
| Compound Name | (E)-1-[(3R)-3-(1-ethylimidazol-2-yl)piperidin-1-yl]pent-3-en-1-one |
|---|---|
| PubChem CID | 97284839 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | (E)-1-[(3R)-3-(1-ethylimidazol-2-yl)piperidin-1-yl]pent-3-en-1-one |
| SMILES | C/C=C/CC(=O)N1CCC[C@@H](c2nccn2CC)C1 |
| InChI | InChI=1S/C15H23N3O/c1-3-5-8-14(19)18-10-6-7-13(12-18)15-16-9-11-17(15)4-2/h3,5,9,11,13H,4,6-8,10,12H2,1-2H3/b5-3+/t13-/m1/s1 |
| InChIKey | RHEHEEFQBPAMGM-MASHWEEQSA-N |
| XLogP | 2.58 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|