C16H28N4O2S — CID 97199500
(3R)-3-(1-butylimidazol-2-yl)-1-pyrrolidin-1-ylsulfonylpiperidine (PubChem CID 97199500) has the molecular formula C16H28N4O2S and a molecular weight of 340.49 g/mol. Its IUPAC name is (3R)-3-(1-butylimidazol-2-yl)-1-pyrrolidin-1-ylsulfonylpiperidine.
| Compound Name | (3R)-3-(1-butylimidazol-2-yl)-1-pyrrolidin-1-ylsulfonylpiperidine |
|---|---|
| PubChem CID | 97199500 |
| Molecular Formula | C16H28N4O2S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (3R)-3-(1-butylimidazol-2-yl)-1-pyrrolidin-1-ylsulfonylpiperidine |
| SMILES | CCCCn1ccnc1[C@@H]1CCCN(S(=O)(=O)N2CCCC2)C1 |
| InChI | InChI=1S/C16H28N4O2S/c1-2-3-9-18-13-8-17-16(18)15-7-6-12-20(14-15)23(21,22)19-10-4-5-11-19/h8,13,15H,2-7,9-12,14H2,1H3/t15-/m1/s1 |
| InChIKey | SLGMTADLJMQOFS-OAHLLOKOSA-N |
| XLogP | 2.20 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |