C18H29FN4O — CID 50976058
1-(3-fluoro-2-pyridinyl)-4-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]piperazine (PubChem CID 50976058) has the molecular formula C18H29FN4O and a molecular weight of 336.45 g/mol. Its IUPAC name is 1-(3-fluoro-2-pyridinyl)-4-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]piperazine.
| Compound Name | 1-(3-fluoro-2-pyridinyl)-4-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]piperazine |
|---|---|
| PubChem CID | 50976058 |
| Molecular Formula | C18H29FN4O |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 1-(3-fluoro-2-pyridinyl)-4-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]piperazine |
| SMILES | COCCN1CCC(CN2CCN(c3ncccc3F)CC2)CC1 |
| InChI | InChI=1S/C18H29FN4O/c1-24-14-13-21-7-4-16(5-8-21)15-22-9-11-23(12-10-22)18-17(19)3-2-6-20-18/h2-3,6,16H,4-5,7-15H2,1H3 |
| InChIKey | MMOBMEGXZIVVSR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |