C15H18FN3S — CID 136513547
1-(3-fluoro-2-pyridinyl)-4-(2-thiophen-2-ylethyl)piperazine (PubChem CID 136513547) has the molecular formula C15H18FN3S and a molecular weight of 291.39 g/mol. Its IUPAC name is 1-(3-fluoro-2-pyridinyl)-4-(2-thiophen-2-ylethyl)piperazine.
| Compound Name | 1-(3-fluoro-2-pyridinyl)-4-(2-thiophen-2-ylethyl)piperazine |
|---|---|
| PubChem CID | 136513547 |
| Molecular Formula | C15H18FN3S |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 1-(3-fluoro-2-pyridinyl)-4-(2-thiophen-2-ylethyl)piperazine |
| SMILES | Fc1cccnc1N1CCN(CCc2cccs2)CC1 |
| InChI | InChI=1S/C15H18FN3S/c16-14-4-1-6-17-15(14)19-10-8-18(9-11-19)7-5-13-3-2-12-20-13/h1-4,6,12H,5,7-11H2 |
| InChIKey | MCPMJEPQEWUWEN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |