C16H20N4O2S — CID 136578933
1-[2-oxo-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]ethyl]pyrimidin-2-one (PubChem CID 136578933) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is 1-[2-oxo-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]ethyl]pyrimidin-2-one.
| Compound Name | 1-[2-oxo-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]ethyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 136578933 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-[2-oxo-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]ethyl]pyrimidin-2-one |
| SMILES | O=C(Cn1cccnc1=O)N1CCN(CCc2cccs2)CC1 |
| InChI | InChI=1S/C16H20N4O2S/c21-15(13-20-6-2-5-17-16(20)22)19-10-8-18(9-11-19)7-4-14-3-1-12-23-14/h1-3,5-6,12H,4,7-11,13H2 |
| InChIKey | OHTZDERTPREFPY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |