C17H24N4OS — CID 136549871
2-(1-ethylpyrazol-3-yl)-1-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]ethanone (PubChem CID 136549871) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is 2-(1-ethylpyrazol-3-yl)-1-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(1-ethylpyrazol-3-yl)-1-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 136549871 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2-(1-ethylpyrazol-3-yl)-1-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]ethanone |
| SMILES | CCn1ccc(CC(=O)N2CCN(CCc3cccs3)CC2)n1 |
| InChI | InChI=1S/C17H24N4OS/c1-2-21-8-5-15(18-21)14-17(22)20-11-9-19(10-12-20)7-6-16-4-3-13-23-16/h3-5,8,13H,2,6-7,9-12,14H2,1H3 |
| InChIKey | MUCPBNZWRLVVBM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |