C10H13NO3S2 — CID 110721392
1-(1,1-dioxo-1,4-thiazinan-4-yl)-2-thiophen-2-ylethanone (PubChem CID 110721392) has the molecular formula C10H13NO3S2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2-thiophen-2-ylethanone.
| Compound Name | 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 110721392 |
| Molecular Formula | C10H13NO3S2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 1-(1,1-dioxo-1,4-thiazinan-4-yl)-2-thiophen-2-ylethanone |
| SMILES | O=C(Cc1cccs1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H13NO3S2/c12-10(8-9-2-1-5-15-9)11-3-6-16(13,14)7-4-11/h1-2,5H,3-4,6-8H2 |
| InChIKey | GFEMLDMVBGKXON-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |