C15H17N3O2S — CID 110802567
1-[4-(1H-pyrrole-3-carbonyl)piperazin-1-yl]-2-thiophen-2-ylethanone (PubChem CID 110802567) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 1-[4-(1H-pyrrole-3-carbonyl)piperazin-1-yl]-2-thiophen-2-ylethanone.
| Compound Name | 1-[4-(1H-pyrrole-3-carbonyl)piperazin-1-yl]-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 110802567 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 1-[4-(1H-pyrrole-3-carbonyl)piperazin-1-yl]-2-thiophen-2-ylethanone |
| SMILES | O=C(Cc1cccs1)N1CCN(C(=O)c2cc[nH]c2)CC1 |
| InChI | InChI=1S/C15H17N3O2S/c19-14(10-13-2-1-9-21-13)17-5-7-18(8-6-17)15(20)12-3-4-16-11-12/h1-4,9,11,16H,5-8,10H2 |
| InChIKey | LSSPINNQIFGPEC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |