C15H20N4OS — CID 56819060
(1-methylpyrazol-4-yl)-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]methanone (PubChem CID 56819060) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is (1-methylpyrazol-4-yl)-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]methanone.
| Compound Name | (1-methylpyrazol-4-yl)-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 56819060 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (1-methylpyrazol-4-yl)-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]methanone |
| SMILES | Cn1cc(C(=O)N2CCN(CCc3cccs3)CC2)cn1 |
| InChI | InChI=1S/C15H20N4OS/c1-17-12-13(11-16-17)15(20)19-8-6-18(7-9-19)5-4-14-3-2-10-21-14/h2-3,10-12H,4-9H2,1H3 |
| InChIKey | OVTNOVPCENUDDP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |