C18H20N4O2S — CID 166230451
[5-(furan-3-yl)-1H-pyrazol-4-yl]-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]methanone (PubChem CID 166230451) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is [5-(furan-3-yl)-1H-pyrazol-4-yl]-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]methanone.
| Compound Name | [5-(furan-3-yl)-1H-pyrazol-4-yl]-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 166230451 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | [5-(furan-3-yl)-1H-pyrazol-4-yl]-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cn[nH]c1-c1ccoc1)N1CCN(CCc2cccs2)CC1 |
| InChI | InChI=1S/C18H20N4O2S/c23-18(16-12-19-20-17(16)14-4-10-24-13-14)22-8-6-21(7-9-22)5-3-15-2-1-11-25-15/h1-2,4,10-13H,3,5-9H2,(H,19,20) |
| InChIKey | WJKPLBOIPLLGRI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |