C16H23N5OS — CID 51084810
N-[2-(1-methylpyrazol-4-yl)ethyl]-4-(thiophen-2-ylmethyl)piperazine-1-carboxamide (PubChem CID 51084810) has the molecular formula C16H23N5OS and a molecular weight of 333.46 g/mol. Its IUPAC name is N-[2-(1-methylpyrazol-4-yl)ethyl]-4-(thiophen-2-ylmethyl)piperazine-1-carboxamide.
| Compound Name | N-[2-(1-methylpyrazol-4-yl)ethyl]-4-(thiophen-2-ylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 51084810 |
| Molecular Formula | C16H23N5OS |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | N-[2-(1-methylpyrazol-4-yl)ethyl]-4-(thiophen-2-ylmethyl)piperazine-1-carboxamide |
| SMILES | Cn1cc(CCNC(=O)N2CCN(Cc3cccs3)CC2)cn1 |
| InChI | InChI=1S/C16H23N5OS/c1-19-12-14(11-18-19)4-5-17-16(22)21-8-6-20(7-9-21)13-15-3-2-10-23-15/h2-3,10-12H,4-9,13H2,1H3,(H,17,22) |
| InChIKey | BAVBZWSZOAXPMH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |