C13H20IN5S — CID 111066876
1-[2-(1-methylpyrazol-4-yl)ethyl]-2-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111066876) has the molecular formula C13H20IN5S and a molecular weight of 405.31 g/mol. Its IUPAC name is 1-[2-(1-methylpyrazol-4-yl)ethyl]-2-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(1-methylpyrazol-4-yl)ethyl]-2-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111066876 |
| Molecular Formula | C13H20IN5S |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 1-[2-(1-methylpyrazol-4-yl)ethyl]-2-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | Cn1cc(CCN/C(N)=N/CCc2cccs2)cn1.I |
| InChI | InChI=1S/C13H19N5S.HI/c1-18-10-11(9-17-18)4-6-15-13(14)16-7-5-12-3-2-8-19-12;/h2-3,8-10H,4-7H2,1H3,(H3,14,15,16);1H |
| InChIKey | KWMWJEPHGYCYRL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|