C23H29N5S — CID 59682699
N-cyclopentyl-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]quinazolin-4-amine (PubChem CID 59682699) has the molecular formula C23H29N5S and a molecular weight of 407.59 g/mol. Its IUPAC name is N-cyclopentyl-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]quinazolin-4-amine.
| Compound Name | N-cyclopentyl-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 59682699 |
| Molecular Formula | C23H29N5S |
| Molecular Weight | 407.59 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | N-cyclopentyl-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]quinazolin-4-amine |
| SMILES | c1csc(CCN2CCN(c3nc(NC4CCCC4)c4ccccc4n3)CC2)c1 |
| InChI | InChI=1S/C23H29N5S/c1-2-7-18(6-1)24-22-20-9-3-4-10-21(20)25-23(26-22)28-15-13-27(14-16-28)12-11-19-8-5-17-29-19/h3-5,8-10,17-18H,1-2,6-7,11-16H2,(H,24,25,26) |
| InChIKey | RJVIQPGZIMTVSQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |