C21H21N7S — CID 91963616
2-(4-pyrimidin-2-ylpiperazin-1-yl)-N-(thiophen-2-ylmethyl)quinazolin-4-amine (PubChem CID 91963616) has the molecular formula C21H21N7S and a molecular weight of 403.52 g/mol. Its IUPAC name is 2-(4-pyrimidin-2-ylpiperazin-1-yl)-N-(thiophen-2-ylmethyl)quinazolin-4-amine.
| Compound Name | 2-(4-pyrimidin-2-ylpiperazin-1-yl)-N-(thiophen-2-ylmethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 91963616 |
| Molecular Formula | C21H21N7S |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 2-(4-pyrimidin-2-ylpiperazin-1-yl)-N-(thiophen-2-ylmethyl)quinazolin-4-amine |
| SMILES | c1cnc(N2CCN(c3nc(NCc4cccs4)c4ccccc4n3)CC2)nc1 |
| InChI | InChI=1S/C21H21N7S/c1-2-7-18-17(6-1)19(24-15-16-5-3-14-29-16)26-21(25-18)28-12-10-27(11-13-28)20-22-8-4-9-23-20/h1-9,14H,10-13,15H2,(H,24,25,26) |
| InChIKey | UMZKAIPLCCOBSE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |