C16H16N4S — CID 91963705
4-N-prop-2-enyl-2-N-(thiophen-2-ylmethyl)quinazoline-2,4-diamine (PubChem CID 91963705) has the molecular formula C16H16N4S and a molecular weight of 296.40 g/mol. Its IUPAC name is 4-N-prop-2-enyl-2-N-(thiophen-2-ylmethyl)quinazoline-2,4-diamine.
| Compound Name | 4-N-prop-2-enyl-2-N-(thiophen-2-ylmethyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 91963705 |
| Molecular Formula | C16H16N4S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 4-N-prop-2-enyl-2-N-(thiophen-2-ylmethyl)quinazoline-2,4-diamine |
| SMILES | C=CCNc1nc(NCc2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C16H16N4S/c1-2-9-17-15-13-7-3-4-8-14(13)19-16(20-15)18-11-12-6-5-10-21-12/h2-8,10H,1,9,11H2,(H2,17,18,19,20) |
| InChIKey | BVHMENUXJKLGLR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|