C20H18N4OS — CID 91963559
4-methyl-2-[[4-(thiophen-2-ylmethylamino)quinazolin-2-yl]amino]phenol (PubChem CID 91963559) has the molecular formula C20H18N4OS and a molecular weight of 362.46 g/mol. Its IUPAC name is 4-methyl-2-[[4-(thiophen-2-ylmethylamino)quinazolin-2-yl]amino]phenol.
| Compound Name | 4-methyl-2-[[4-(thiophen-2-ylmethylamino)quinazolin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 91963559 |
| Molecular Formula | C20H18N4OS |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 4-methyl-2-[[4-(thiophen-2-ylmethylamino)quinazolin-2-yl]amino]phenol |
| SMILES | Cc1ccc(O)c(Nc2nc(NCc3cccs3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C20H18N4OS/c1-13-8-9-18(25)17(11-13)23-20-22-16-7-3-2-6-15(16)19(24-20)21-12-14-5-4-10-26-14/h2-11,25H,12H2,1H3,(H2,21,22,23,24) |
| InChIKey | SHQCFXWDKVCGLO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|