C25H30Cl2N4S — CID 23345124
1-benzyl-N-[1-(2-thiophen-2-ylethyl)piperidin-4-yl]benzimidazol-2-amine;dihydrochloride (PubChem CID 23345124) has the molecular formula C25H30Cl2N4S and a molecular weight of 489.52 g/mol. Its IUPAC name is 1-benzyl-N-[1-(2-thiophen-2-ylethyl)piperidin-4-yl]benzimidazol-2-amine;dihydrochloride.
| Compound Name | 1-benzyl-N-[1-(2-thiophen-2-ylethyl)piperidin-4-yl]benzimidazol-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 23345124 |
| Molecular Formula | C25H30Cl2N4S |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 1-benzyl-N-[1-(2-thiophen-2-ylethyl)piperidin-4-yl]benzimidazol-2-amine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(Cn2c(NC3CCN(CCc4cccs4)CC3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C25H28N4S.2ClH/c1-2-7-20(8-3-1)19-29-24-11-5-4-10-23(24)27-25(29)26-21-12-15-28(16-13-21)17-14-22-9-6-18-30-22;;/h1-11,18,21H,12-17,19H2,(H,26,27);2*1H |
| InChIKey | HSWUEBUIULXOTF-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |