C25H28ClN5O2 — CID 59682659
2-(2-chlorophenoxy)-1-[4-[4-(cyclopentylamino)quinazolin-2-yl]piperazin-1-yl]ethanone (PubChem CID 59682659) has the molecular formula C25H28ClN5O2 and a molecular weight of 465.99 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-1-[4-[4-(cyclopentylamino)quinazolin-2-yl]piperazin-1-yl]ethanone.
| Compound Name | 2-(2-chlorophenoxy)-1-[4-[4-(cyclopentylamino)quinazolin-2-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 59682659 |
| Molecular Formula | C25H28ClN5O2 |
| Molecular Weight | 465.99 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 2-(2-chlorophenoxy)-1-[4-[4-(cyclopentylamino)quinazolin-2-yl]piperazin-1-yl]ethanone |
| SMILES | O=C(COc1ccccc1Cl)N1CCN(c2nc(NC3CCCC3)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C25H28ClN5O2/c26-20-10-4-6-12-22(20)33-17-23(32)30-13-15-31(16-14-30)25-28-21-11-5-3-9-19(21)24(29-25)27-18-7-1-2-8-18/h3-6,9-12,18H,1-2,7-8,13-17H2,(H,27,28,29) |
| InChIKey | HPCWDGKKPRMXFT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.99 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |