C31H34N6O — CID 71571140
[4-[4-[(1-benzylpiperidin-4-yl)amino]quinazolin-2-yl]piperazin-1-yl]-phenylmethanone (PubChem CID 71571140) has the molecular formula C31H34N6O and a molecular weight of 506.65 g/mol. Its IUPAC name is [4-[4-[(1-benzylpiperidin-4-yl)amino]quinazolin-2-yl]piperazin-1-yl]-phenylmethanone.
| Compound Name | [4-[4-[(1-benzylpiperidin-4-yl)amino]quinazolin-2-yl]piperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 71571140 |
| Molecular Formula | C31H34N6O |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | [4-[4-[(1-benzylpiperidin-4-yl)amino]quinazolin-2-yl]piperazin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCN(c2nc(NC3CCN(Cc4ccccc4)CC3)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C31H34N6O/c38-30(25-11-5-2-6-12-25)36-19-21-37(22-20-36)31-33-28-14-8-7-13-27(28)29(34-31)32-26-15-17-35(18-16-26)23-24-9-3-1-4-10-24/h1-14,26H,15-23H2,(H,32,33,34) |
| InChIKey | AFBCKXIVQSPLIU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |