C31H35N5O — CID 16729343
[9-[(1-benzylpiperidin-4-yl)amino]acridin-1-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 16729343) has the molecular formula C31H35N5O and a molecular weight of 493.66 g/mol. Its IUPAC name is [9-[(1-benzylpiperidin-4-yl)amino]acridin-1-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [9-[(1-benzylpiperidin-4-yl)amino]acridin-1-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 16729343 |
| Molecular Formula | C31H35N5O |
| Molecular Weight | 493.66 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | [9-[(1-benzylpiperidin-4-yl)amino]acridin-1-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2cccc3nc4ccccc4c(NC4CCN(Cc5ccccc5)CC4)c23)CC1 |
| InChI | InChI=1S/C31H35N5O/c1-34-18-20-36(21-19-34)31(37)26-11-7-13-28-29(26)30(25-10-5-6-12-27(25)33-28)32-24-14-16-35(17-15-24)22-23-8-3-2-4-9-23/h2-13,24H,14-22H2,1H3,(H,32,33) |
| InChIKey | CZXFKUKRCNRTPL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.66 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|