C25H24N4O — CID 135921332
2-[4-[[(3S)-1-benzylpyrrolidin-3-yl]amino]quinazolin-2-yl]phenol (PubChem CID 135921332) has the molecular formula C25H24N4O and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-[4-[[(3S)-1-benzylpyrrolidin-3-yl]amino]quinazolin-2-yl]phenol.
| Compound Name | 2-[4-[[(3S)-1-benzylpyrrolidin-3-yl]amino]quinazolin-2-yl]phenol |
|---|---|
| PubChem CID | 135921332 |
| Molecular Formula | C25H24N4O |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 2-[4-[[(3S)-1-benzylpyrrolidin-3-yl]amino]quinazolin-2-yl]phenol |
| SMILES | Oc1ccccc1-c1nc(N[C@H]2CCN(Cc3ccccc3)C2)c2ccccc2n1 |
| InChI | InChI=1S/C25H24N4O/c30-23-13-7-5-11-21(23)25-27-22-12-6-4-10-20(22)24(28-25)26-19-14-15-29(17-19)16-18-8-2-1-3-9-18/h1-13,19,30H,14-17H2,(H,26,27,28)/t19-/m0/s1 |
| InChIKey | ZVAZJWUOJHOGHU-IBGZPJMESA-N |
| XLogP | 4.69 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |